C26H28F3N3O4 — CID 122193391
ethyl 4-[4-(3-morpholin-4-ylpropoxy)anilino]-6-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 122193391) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is ethyl 4-[4-(3-morpholin-4-ylpropoxy)anilino]-6-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-(3-morpholin-4-ylpropoxy)anilino]-6-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 122193391 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | ethyl 4-[4-(3-morpholin-4-ylpropoxy)anilino]-6-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C(F)(F)F)cc2c1Nc1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28F3N3O4/c1-2-35-25(33)22-17-30-23-9-4-18(26(27,28)29)16-21(23)24(22)31-19-5-7-20(8-6-19)36-13-3-10-32-11-14-34-15-12-32/h4-9,16-17H,2-3,10-15H2,1H3,(H,30,31) |
| InChIKey | ADWURTUVOMHDIA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|