C24H30N6O3 — CID 122193458
6-methoxy-4-[4-(3-morpholin-4-ylpropylamino)anilino]quinoline-3-carbohydrazide (PubChem CID 122193458) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 6-methoxy-4-[4-(3-morpholin-4-ylpropylamino)anilino]quinoline-3-carbohydrazide.
| Compound Name | 6-methoxy-4-[4-(3-morpholin-4-ylpropylamino)anilino]quinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 122193458 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 6-methoxy-4-[4-(3-morpholin-4-ylpropylamino)anilino]quinoline-3-carbohydrazide |
| SMILES | COc1ccc2ncc(C(=O)NN)c(Nc3ccc(NCCCN4CCOCC4)cc3)c2c1 |
| InChI | InChI=1S/C24H30N6O3/c1-32-19-7-8-22-20(15-19)23(21(16-27-22)24(31)29-25)28-18-5-3-17(4-6-18)26-9-2-10-30-11-13-33-14-12-30/h3-8,15-16,26H,2,9-14,25H2,1H3,(H,27,28)(H,29,31) |
| InChIKey | RPFFDWYEPQTHJD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|