C20H23N3O4 — CID 22582811
6-methoxy-N-(3-morpholin-4-ylpropyl)furo[2,3-b]quinoline-2-carboxamide (PubChem CID 22582811) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6-methoxy-N-(3-morpholin-4-ylpropyl)furo[2,3-b]quinoline-2-carboxamide.
| Compound Name | 6-methoxy-N-(3-morpholin-4-ylpropyl)furo[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 22582811 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6-methoxy-N-(3-morpholin-4-ylpropyl)furo[2,3-b]quinoline-2-carboxamide |
| SMILES | COc1ccc2nc3oc(C(=O)NCCCN4CCOCC4)cc3cc2c1 |
| InChI | InChI=1S/C20H23N3O4/c1-25-16-3-4-17-14(12-16)11-15-13-18(27-20(15)22-17)19(24)21-5-2-6-23-7-9-26-10-8-23/h3-4,11-13H,2,5-10H2,1H3,(H,21,24) |
| InChIKey | CVZBEDXTVGTZKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|