C19H24N4O4S — CID 84555624
2-[(4-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 84555624) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84555624 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)NCCCN3CCOCC3)cs2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-26-15-5-3-14(4-6-15)17(24)22-19-21-16(13-28-19)18(25)20-7-2-8-23-9-11-27-12-10-23/h3-6,13H,2,7-12H2,1H3,(H,20,25)(H,21,22,24) |
| InChIKey | GDFBAEIJWJUPFF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|