C20H27N3O3 — CID 1188194
ethyl 6-ethyl-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate (PubChem CID 1188194) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 6-ethyl-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 6-ethyl-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1188194 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | ethyl 6-ethyl-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(CC)cc2c1NCCN1CCOCC1 |
| InChI | InChI=1S/C20H27N3O3/c1-3-15-5-6-18-16(13-15)19(17(14-22-18)20(24)26-4-2)21-7-8-23-9-11-25-12-10-23/h5-6,13-14H,3-4,7-12H2,1-2H3,(H,21,22) |
| InChIKey | QEEDAYFDSLMXLF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |