C19H24Cl3N3O3 — CID 2790720
ethyl 7,8-dichloro-4-(3-morpholin-4-ylpropylamino)quinoline-3-carboxylate;hydrochloride (PubChem CID 2790720) has the molecular formula C19H24Cl3N3O3 and a molecular weight of 448.78 g/mol. Its IUPAC name is ethyl 7,8-dichloro-4-(3-morpholin-4-ylpropylamino)quinoline-3-carboxylate;hydrochloride.
| Compound Name | ethyl 7,8-dichloro-4-(3-morpholin-4-ylpropylamino)quinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2790720 |
| Molecular Formula | C19H24Cl3N3O3 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | ethyl 7,8-dichloro-4-(3-morpholin-4-ylpropylamino)quinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnc2c(Cl)c(Cl)ccc2c1NCCCN1CCOCC1.Cl |
| InChI | InChI=1S/C19H23Cl2N3O3.ClH/c1-2-27-19(25)14-12-23-18-13(4-5-15(20)16(18)21)17(14)22-6-3-7-24-8-10-26-11-9-24;/h4-5,12H,2-3,6-11H2,1H3,(H,22,23);1H |
| InChIKey | SWFNVKUDNQUXKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|