C18H21Cl2N3O3 — CID 1187153
ethyl 7,8-dichloro-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate (PubChem CID 1187153) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is ethyl 7,8-dichloro-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 7,8-dichloro-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1187153 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | ethyl 7,8-dichloro-4-(2-morpholin-4-ylethylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Cl)c(Cl)ccc2c1NCCN1CCOCC1 |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-2-26-18(24)13-11-22-17-12(3-4-14(19)15(17)20)16(13)21-5-6-23-7-9-25-10-8-23/h3-4,11H,2,5-10H2,1H3,(H,21,22) |
| InChIKey | STNYKOYIGYMNAT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |