C25H27N3O5 — CID 1190175
diethyl 4-(4-morpholin-4-ylanilino)quinoline-3,6-dicarboxylate (PubChem CID 1190175) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is diethyl 4-(4-morpholin-4-ylanilino)quinoline-3,6-dicarboxylate.
| Compound Name | diethyl 4-(4-morpholin-4-ylanilino)quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 1190175 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | diethyl 4-(4-morpholin-4-ylanilino)quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(Nc3ccc(N4CCOCC4)cc3)c2c1 |
| InChI | InChI=1S/C25H27N3O5/c1-3-32-24(29)17-5-10-22-20(15-17)23(21(16-26-22)25(30)33-4-2)27-18-6-8-19(9-7-18)28-11-13-31-14-12-28/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,26,27) |
| InChIKey | XOKPVAFBMLWNSV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|