C21H20N2O4 — CID 1180834
ethyl 4-(4-methoxycarbonylanilino)-6-methylquinoline-3-carboxylate (PubChem CID 1180834) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl 4-(4-methoxycarbonylanilino)-6-methylquinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-methoxycarbonylanilino)-6-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 1180834 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | ethyl 4-(4-methoxycarbonylanilino)-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C)cc2c1Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-4-27-21(25)17-12-22-18-10-5-13(2)11-16(18)19(17)23-15-8-6-14(7-9-15)20(24)26-3/h5-12H,4H2,1-3H3,(H,22,23) |
| InChIKey | NNRSAQGWAPWRSM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |