C15H16N2O4 — CID 46397906
3-O-ethyl 7-O-methyl 4-(methylamino)quinoline-3,7-dicarboxylate (PubChem CID 46397906) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-O-ethyl 7-O-methyl 4-(methylamino)quinoline-3,7-dicarboxylate.
| Compound Name | 3-O-ethyl 7-O-methyl 4-(methylamino)quinoline-3,7-dicarboxylate |
|---|---|
| PubChem CID | 46397906 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-O-ethyl 7-O-methyl 4-(methylamino)quinoline-3,7-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(=O)OC)ccc2c1NC |
| InChI | InChI=1S/C15H16N2O4/c1-4-21-15(19)11-8-17-12-7-9(14(18)20-3)5-6-10(12)13(11)16-2/h5-8H,4H2,1-3H3,(H,16,17) |
| InChIKey | CHDWPUXMNPAXQX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |