C14H15ClN2O3 — CID 54773034
ethyl 7-chloro-6-methoxy-4-(methylamino)quinoline-3-carboxylate (PubChem CID 54773034) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is ethyl 7-chloro-6-methoxy-4-(methylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 7-chloro-6-methoxy-4-(methylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 54773034 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 7-chloro-6-methoxy-4-(methylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(Cl)c(OC)cc2c1NC |
| InChI | InChI=1S/C14H15ClN2O3/c1-4-20-14(18)9-7-17-11-6-10(15)12(19-3)5-8(11)13(9)16-2/h5-7H,4H2,1-3H3,(H,16,17) |
| InChIKey | BVFSODFLEVXKLD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |