C14H12BrF3N2O2 — CID 150234989
ethyl 6-bromo-4-(methylamino)-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 150234989) has the molecular formula C14H12BrF3N2O2 and a molecular weight of 377.16 g/mol. Its IUPAC name is ethyl 6-bromo-4-(methylamino)-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-(methylamino)-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 150234989 |
| Molecular Formula | C14H12BrF3N2O2 |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | ethyl 6-bromo-4-(methylamino)-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)c(Br)cc2c1NC |
| InChI | InChI=1S/C14H12BrF3N2O2/c1-3-22-13(21)8-6-20-11-5-9(14(16,17)18)10(15)4-7(11)12(8)19-2/h4-6H,3H2,1-2H3,(H,19,20) |
| InChIKey | FWHRBNWPIAPIDV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |