C21H21BrN2O4 — CID 151694094
ethyl 6-bromo-7-methoxy-4-[(4-methoxyphenyl)methylamino]quinoline-3-carboxylate (PubChem CID 151694094) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is ethyl 6-bromo-7-methoxy-4-[(4-methoxyphenyl)methylamino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-bromo-7-methoxy-4-[(4-methoxyphenyl)methylamino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 151694094 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | ethyl 6-bromo-7-methoxy-4-[(4-methoxyphenyl)methylamino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)c(Br)cc2c1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21BrN2O4/c1-4-28-21(25)16-12-23-18-10-19(27-3)17(22)9-15(18)20(16)24-11-13-5-7-14(26-2)8-6-13/h5-10,12H,4,11H2,1-3H3,(H,23,24) |
| InChIKey | RDELTPAZIXJNNC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |