C20H29FN2O3 — CID 143010924
ethane;ethyl 5-fluoro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate (PubChem CID 143010924) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is ethane;ethyl 5-fluoro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethane;ethyl 5-fluoro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 143010924 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethane;ethyl 5-fluoro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1cc(F)cnc1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H17FN2O3.2C2H6/c1-3-22-16(20)14-8-12(17)10-19-15(14)18-9-11-4-6-13(21-2)7-5-11;2*1-2/h4-8,10H,3,9H2,1-2H3,(H,18,19);2*1-2H3 |
| InChIKey | GYCYUSNZRVKNBG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |