C22H20IN3O3 — CID 89360155
ethyl 6-cyano-4-[[3-(iodomethyl)-4-methoxyphenyl]methylamino]quinoline-3-carboxylate (PubChem CID 89360155) has the molecular formula C22H20IN3O3 and a molecular weight of 501.32 g/mol. Its IUPAC name is ethyl 6-cyano-4-[[3-(iodomethyl)-4-methoxyphenyl]methylamino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-cyano-4-[[3-(iodomethyl)-4-methoxyphenyl]methylamino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 89360155 |
| Molecular Formula | C22H20IN3O3 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | ethyl 6-cyano-4-[[3-(iodomethyl)-4-methoxyphenyl]methylamino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C#N)cc2c1NCc1ccc(OC)c(CI)c1 |
| InChI | InChI=1S/C22H20IN3O3/c1-3-29-22(27)18-13-25-19-6-4-14(11-24)9-17(19)21(18)26-12-15-5-7-20(28-2)16(8-15)10-23/h4-9,13H,3,10,12H2,1-2H3,(H,25,26) |
| InChIKey | BHYUUJFZCPHZRV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|