C23H22ClN5O3 — CID 22601604
N-(2-acetamidoethyl)-4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-3-carboxamide (PubChem CID 22601604) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22601604 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-3-carboxamide |
| SMILES | COc1ccc(CNc2c(C(=O)NCCNC(C)=O)cnc3ccc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C23H22ClN5O3/c1-14(30)26-7-8-27-23(31)18-13-28-20-5-3-15(11-25)9-17(20)22(18)29-12-16-4-6-21(32-2)19(24)10-16/h3-6,9-10,13H,7-8,12H2,1-2H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | IXELNAWGJZRKPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|