C25H29ClN4O — CID 22601654
4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(3,3-dimethylbutylamino)methyl]quinoline-6-carbonitrile (PubChem CID 22601654) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(3,3-dimethylbutylamino)methyl]quinoline-6-carbonitrile.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(3,3-dimethylbutylamino)methyl]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 22601654 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(3,3-dimethylbutylamino)methyl]quinoline-6-carbonitrile |
| SMILES | COc1ccc(CNc2c(CNCCC(C)(C)C)cnc3ccc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C25H29ClN4O/c1-25(2,3)9-10-28-15-19-16-29-22-7-5-17(13-27)11-20(22)24(19)30-14-18-6-8-23(31-4)21(26)12-18/h5-8,11-12,16,28H,9-10,14-15H2,1-4H3,(H,29,30) |
| InChIKey | XIEAOYQNDNNXCZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|