C23H23ClN4O4 — CID 22601552
4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyano-N-[2-(2-hydroxyethoxy)ethyl]quinoline-3-carboxamide (PubChem CID 22601552) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyano-N-[2-(2-hydroxyethoxy)ethyl]quinoline-3-carboxamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyano-N-[2-(2-hydroxyethoxy)ethyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 22601552 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyano-N-[2-(2-hydroxyethoxy)ethyl]quinoline-3-carboxamide |
| SMILES | COc1ccc(CNc2c(C(=O)NCCOCCO)cnc3ccc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O4/c1-31-21-5-3-16(11-19(21)24)13-28-22-17-10-15(12-25)2-4-20(17)27-14-18(22)23(30)26-6-8-32-9-7-29/h2-5,10-11,14,29H,6-9,13H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | DZPOWJBWBNOQEQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|