C21H21ClN4O2 — CID 22601561
4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(2-hydroxyethylamino)methyl]quinoline-6-carbonitrile (PubChem CID 22601561) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(2-hydroxyethylamino)methyl]quinoline-6-carbonitrile.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(2-hydroxyethylamino)methyl]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 22601561 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-3-[(2-hydroxyethylamino)methyl]quinoline-6-carbonitrile |
| SMILES | COc1ccc(CNc2c(CNCCO)cnc3ccc(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C21H21ClN4O2/c1-28-20-5-3-15(9-18(20)22)11-26-21-16(12-24-6-7-27)13-25-19-4-2-14(10-23)8-17(19)21/h2-5,8-9,13,24,27H,6-7,11-12H2,1H3,(H,25,26) |
| InChIKey | ISKORDCUFHBZJW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|