C23H23ClN4O2 — CID 90910028
4-[(3-chloro-4-methoxyphenyl)methylamino]-6-(4-cyanobutyl)quinoline-3-carboxamide (PubChem CID 90910028) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-(4-cyanobutyl)quinoline-3-carboxamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-(4-cyanobutyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 90910028 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-6-(4-cyanobutyl)quinoline-3-carboxamide |
| SMILES | COc1ccc(CNc2c(C(N)=O)cnc3ccc(CCCCC#N)cc23)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O2/c1-30-21-9-7-16(12-19(21)24)13-28-22-17-11-15(5-3-2-4-10-25)6-8-20(17)27-14-18(22)23(26)29/h6-9,11-12,14H,2-5,13H2,1H3,(H2,26,29)(H,27,28) |
| InChIKey | AFESDNIMKXZEMF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|