C13H14ClN3O3 — CID 107623171
ethyl 6-chloro-4-hydrazinyl-7-methoxyquinoline-3-carboxylate (PubChem CID 107623171) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is ethyl 6-chloro-4-hydrazinyl-7-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-hydrazinyl-7-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 107623171 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | ethyl 6-chloro-4-hydrazinyl-7-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)c(Cl)cc2c1NN |
| InChI | InChI=1S/C13H14ClN3O3/c1-3-20-13(18)8-6-16-10-5-11(19-2)9(14)4-7(10)12(8)17-15/h4-6H,3,15H2,1-2H3,(H,16,17) |
| InChIKey | HYKXXKPMHZYQNG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|