C21H18ClF3N2O3 — CID 15992869
ethyl 4-(4-chloro-2-methoxy-5-methylanilino)-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 15992869) has the molecular formula C21H18ClF3N2O3 and a molecular weight of 438.83 g/mol. Its IUPAC name is ethyl 4-(4-chloro-2-methoxy-5-methylanilino)-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-chloro-2-methoxy-5-methylanilino)-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 15992869 |
| Molecular Formula | C21H18ClF3N2O3 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 4-(4-chloro-2-methoxy-5-methylanilino)-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)ccc2c1Nc1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C21H18ClF3N2O3/c1-4-30-20(28)14-10-26-16-8-12(21(23,24)25)5-6-13(16)19(14)27-17-7-11(2)15(22)9-18(17)29-3/h5-10H,4H2,1-3H3,(H,26,27) |
| InChIKey | NINWGAXZGYJDON-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |