C23H19F3N2O6 — CID 23477154
dimethyl 2-[[3-ethoxycarbonyl-7-(trifluoromethyl)quinolin-4-yl]amino]benzene-1,4-dicarboxylate (PubChem CID 23477154) has the molecular formula C23H19F3N2O6 and a molecular weight of 476.41 g/mol. Its IUPAC name is dimethyl 2-[[3-ethoxycarbonyl-7-(trifluoromethyl)quinolin-4-yl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[3-ethoxycarbonyl-7-(trifluoromethyl)quinolin-4-yl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23477154 |
| Molecular Formula | C23H19F3N2O6 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | dimethyl 2-[[3-ethoxycarbonyl-7-(trifluoromethyl)quinolin-4-yl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)ccc2c1Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C23H19F3N2O6/c1-4-34-22(31)16-11-27-17-10-13(23(24,25)26)6-8-14(17)19(16)28-18-9-12(20(29)32-2)5-7-15(18)21(30)33-3/h5-11H,4H2,1-3H3,(H,27,28) |
| InChIKey | BZULGPLNGSUTBG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|