C22H16F3N5O6S2 — CID 23477214
ethyl 4-[4-[(5-nitro-1,3-thiazol-2-yl)sulfamoyl]anilino]-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 23477214) has the molecular formula C22H16F3N5O6S2 and a molecular weight of 567.53 g/mol. Its IUPAC name is ethyl 4-[4-[(5-nitro-1,3-thiazol-2-yl)sulfamoyl]anilino]-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-[(5-nitro-1,3-thiazol-2-yl)sulfamoyl]anilino]-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 23477214 |
| Molecular Formula | C22H16F3N5O6S2 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | ethyl 4-[4-[(5-nitro-1,3-thiazol-2-yl)sulfamoyl]anilino]-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)ccc2c1Nc1ccc(S(=O)(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C22H16F3N5O6S2/c1-2-36-20(31)16-10-26-17-9-12(22(23,24)25)3-8-15(17)19(16)28-13-4-6-14(7-5-13)38(34,35)29-21-27-11-18(37-21)30(32)33/h3-11H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | ZKMVSQBDYYJWCI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|