C19H13Cl2F3N2O2 — CID 23477194
ethyl 4-(2,4-dichloroanilino)-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 23477194) has the molecular formula C19H13Cl2F3N2O2 and a molecular weight of 429.23 g/mol. Its IUPAC name is ethyl 4-(2,4-dichloroanilino)-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(2,4-dichloroanilino)-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 23477194 |
| Molecular Formula | C19H13Cl2F3N2O2 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | ethyl 4-(2,4-dichloroanilino)-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)ccc2c1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl2F3N2O2/c1-2-28-18(27)13-9-25-16-7-10(19(22,23)24)3-5-12(16)17(13)26-15-6-4-11(20)8-14(15)21/h3-9H,2H2,1H3,(H,25,26) |
| InChIKey | LHSGRLHLBRPPHN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |