C13H11F3N2O2 — CID 62809200
ethyl 5,6,8-trifluoro-4-(methylamino)quinoline-3-carboxylate (PubChem CID 62809200) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is ethyl 5,6,8-trifluoro-4-(methylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 5,6,8-trifluoro-4-(methylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 62809200 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 5,6,8-trifluoro-4-(methylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(F)cc(F)c(F)c2c1NC |
| InChI | InChI=1S/C13H11F3N2O2/c1-3-20-13(19)6-5-18-12-8(15)4-7(14)10(16)9(12)11(6)17-2/h4-5H,3H2,1-2H3,(H,17,18) |
| InChIKey | JSQQPPURIYUGBY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|