C12H7BrClF2NO2 — CID 102854004
ethyl 5-bromo-4-chloro-6,8-difluoroquinoline-3-carboxylate (PubChem CID 102854004) has the molecular formula C12H7BrClF2NO2 and a molecular weight of 350.55 g/mol. Its IUPAC name is ethyl 5-bromo-4-chloro-6,8-difluoroquinoline-3-carboxylate.
| Compound Name | ethyl 5-bromo-4-chloro-6,8-difluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102854004 |
| Molecular Formula | C12H7BrClF2NO2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | ethyl 5-bromo-4-chloro-6,8-difluoroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(F)cc(F)c(Br)c2c1Cl |
| InChI | InChI=1S/C12H7BrClF2NO2/c1-2-19-12(18)5-4-17-11-7(16)3-6(15)9(13)8(11)10(5)14/h3-4H,2H2,1H3 |
| InChIKey | DEBMDKQFUQUQGP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|