C11H7F3N2O2 — CID 102614880
methyl 4-amino-5,6,8-trifluoroquinoline-3-carboxylate (PubChem CID 102614880) has the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. Its IUPAC name is methyl 4-amino-5,6,8-trifluoroquinoline-3-carboxylate.
| Compound Name | methyl 4-amino-5,6,8-trifluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614880 |
| Molecular Formula | C11H7F3N2O2 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | methyl 4-amino-5,6,8-trifluoroquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(F)cc(F)c(F)c2c1N |
| InChI | InChI=1S/C11H7F3N2O2/c1-18-11(17)4-3-16-10-6(13)2-5(12)8(14)7(10)9(4)15/h2-3H,1H3,(H2,15,16) |
| InChIKey | CIBPBWROZYBFBX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|