C13H8Cl2F3NO2 — CID 66487307
ethyl 4,6-dichloro-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 66487307) has the molecular formula C13H8Cl2F3NO2 and a molecular weight of 338.11 g/mol. Its IUPAC name is ethyl 4,6-dichloro-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4,6-dichloro-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 66487307 |
| Molecular Formula | C13H8Cl2F3NO2 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | ethyl 4,6-dichloro-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(C(F)(F)F)c(Cl)cc2c1Cl |
| InChI | InChI=1S/C13H8Cl2F3NO2/c1-2-21-12(20)7-5-19-10-4-8(13(16,17)18)9(14)3-6(10)11(7)15/h3-5H,2H2,1H3 |
| InChIKey | NIHJXGAANWFQBX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |