C23H20N4O5 — CID 39851583
ethyl 4-amino-6-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]quinoline-3-carboxylate (PubChem CID 39851583) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is ethyl 4-amino-6-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]quinoline-3-carboxylate.
| Compound Name | ethyl 4-amino-6-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 39851583 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | ethyl 4-amino-6-[[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(NC(=O)c3ccc(N4C(=O)CCC4=O)cc3)cc2c1N |
| InChI | InChI=1S/C23H20N4O5/c1-2-32-23(31)17-12-25-18-8-5-14(11-16(18)21(17)24)26-22(30)13-3-6-15(7-4-13)27-19(28)9-10-20(27)29/h3-8,11-12H,2,9-10H2,1H3,(H2,24,25)(H,26,30) |
| InChIKey | UEJBBMPUKBEVTB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|