C20H16F4N2O2 — CID 156881974
ethyl 4-(dimethylamino)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate (PubChem CID 156881974) has the molecular formula C20H16F4N2O2 and a molecular weight of 392.35 g/mol. Its IUPAC name is ethyl 4-(dimethylamino)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(dimethylamino)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 156881974 |
| Molecular Formula | C20H16F4N2O2 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | ethyl 4-(dimethylamino)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc2c1N(C)C |
| InChI | InChI=1S/C20H16F4N2O2/c1-4-28-20(27)13-9-25-18-11(19(13)26(2)3)5-6-14(22)16(18)12-7-10(21)8-15(23)17(12)24/h5-9H,4H2,1-3H3 |
| InChIKey | ABPMQYUTJZMQQW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|