C18H11BrF3NO2 — CID 156881977
ethyl 4-bromo-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate (PubChem CID 156881977) has the molecular formula C18H11BrF3NO2 and a molecular weight of 410.19 g/mol. Its IUPAC name is ethyl 4-bromo-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-bromo-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 156881977 |
| Molecular Formula | C18H11BrF3NO2 |
| Molecular Weight | 410.19 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | ethyl 4-bromo-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(-c3cc(F)cc(F)c3F)cccc2c1Br |
| InChI | InChI=1S/C18H11BrF3NO2/c1-2-25-18(24)13-8-23-17-10(4-3-5-11(17)15(13)19)12-6-9(20)7-14(21)16(12)22/h3-8H,2H2,1H3 |
| InChIKey | PBDUNYANVRJICK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.19 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|