C27H21F3N2O3 — CID 134511483
N-(3,4-dihydro-2H-chromen-4-yl)-4-(methoxymethyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 134511483) has the molecular formula C27H21F3N2O3 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-4-(methoxymethyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(methoxymethyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 134511483 |
| Molecular Formula | C27H21F3N2O3 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(methoxymethyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | COCc1c(C(=O)NC2CCOc3ccccc32)cnc2c(-c3cc(F)cc(F)c3F)cccc12 |
| InChI | InChI=1S/C27H21F3N2O3/c1-34-14-21-17-7-4-6-16(19-11-15(28)12-22(29)25(19)30)26(17)31-13-20(21)27(33)32-23-9-10-35-24-8-3-2-5-18(23)24/h2-8,11-13,23H,9-10,14H2,1H3,(H,32,33) |
| InChIKey | SIDAGZDAGDVSHJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|