C25H25N3O3 — CID 137462490
N-(3,4-dihydro-2H-chromen-4-yl)-4-(dimethylamino)-8-(3-methoxyprop-1-ynyl)quinoline-3-carboxamide (PubChem CID 137462490) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-4-(dimethylamino)-8-(3-methoxyprop-1-ynyl)quinoline-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(dimethylamino)-8-(3-methoxyprop-1-ynyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 137462490 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(dimethylamino)-8-(3-methoxyprop-1-ynyl)quinoline-3-carboxamide |
| SMILES | COCC#Cc1cccc2c(N(C)C)c(C(=O)NC3CCOc4ccccc43)cnc12 |
| InChI | InChI=1S/C25H25N3O3/c1-28(2)24-19-11-6-8-17(9-7-14-30-3)23(19)26-16-20(24)25(29)27-21-13-15-31-22-12-5-4-10-18(21)22/h4-6,8,10-12,16,21H,13-15H2,1-3H3,(H,27,29) |
| InChIKey | RCZZGYDFIZAATM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|