C25H16ClF3N2O2 — CID 134502143
4-chloro-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 134502143) has the molecular formula C25H16ClF3N2O2 and a molecular weight of 468.86 g/mol. Its IUPAC name is 4-chloro-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | 4-chloro-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 134502143 |
| Molecular Formula | C25H16ClF3N2O2 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-chloro-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | O=C(N[C@H]1CCOc2ccccc21)c1cnc2c(-c3cc(F)cc(F)c3F)cccc2c1Cl |
| InChI | InChI=1S/C25H16ClF3N2O2/c26-22-16-6-3-5-14(17-10-13(27)11-19(28)23(17)29)24(16)30-12-18(22)25(32)31-20-8-9-33-21-7-2-1-4-15(20)21/h1-7,10-12,20H,8-9H2,(H,31,32)/t20-/m0/s1 |
| InChIKey | HSHHGLOBIRWIOA-FQEVSTJZSA-N |
| XLogP | 6.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|