C29H21F5N2O2 — CID 167506426
N-(3,4-dihydro-2H-chromen-4-yl)-7-fluoro-4-(3-fluorocyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 167506426) has the molecular formula C29H21F5N2O2 and a molecular weight of 524.49 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-7-fluoro-4-(3-fluorocyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-7-fluoro-4-(3-fluorocyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 167506426 |
| Molecular Formula | C29H21F5N2O2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-7-fluoro-4-(3-fluorocyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc2c1C1CC(F)C1 |
| InChI | InChI=1S/C29H21F5N2O2/c30-15-9-14(10-15)25-18-5-6-21(32)26(19-11-16(31)12-22(33)27(19)34)28(18)35-13-20(25)29(37)36-23-7-8-38-24-4-2-1-3-17(23)24/h1-6,11-15,23H,7-10H2,(H,36,37) |
| InChIKey | ZBOOZFLSCMHXMY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|