C27H20F4N2O2 — CID 156881964
(4S)-N-[4-ethyl-7-fluoro-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 156881964) has the molecular formula C27H20F4N2O2 and a molecular weight of 480.46 g/mol. Its IUPAC name is (4S)-N-[4-ethyl-7-fluoro-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | (4S)-N-[4-ethyl-7-fluoro-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 156881964 |
| Molecular Formula | C27H20F4N2O2 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (4S)-N-[4-ethyl-7-fluoro-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | CCc1c(NC(=O)[C@H]2CCOc3ccccc32)cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc12 |
| InChI | InChI=1S/C27H20F4N2O2/c1-2-15-17-7-8-20(29)24(19-11-14(28)12-21(30)25(19)31)26(17)32-13-22(15)33-27(34)18-9-10-35-23-6-4-3-5-16(18)23/h3-8,11-13,18H,2,9-10H2,1H3,(H,33,34)/t18-/m0/s1 |
| InChIKey | IAESBMCJNHGFJG-SFHVURJKSA-N |
| XLogP | 6.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|