C16H13FINO2 — CID 79760288
N-(4-fluoro-2-iodophenyl)-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 79760288) has the molecular formula C16H13FINO2 and a molecular weight of 397.19 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 79760288 |
| Molecular Formula | C16H13FINO2 |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1I)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H13FINO2/c17-10-5-6-14(13(18)9-10)19-16(20)12-7-8-21-15-4-2-1-3-11(12)15/h1-6,9,12H,7-8H2,(H,19,20) |
| InChIKey | AKKCQBBPYQFWAD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|