C17H15NO3 — CID 106912130
N-(4-formylphenyl)-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 106912130) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-(4-formylphenyl)-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-(4-formylphenyl)-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 106912130 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(4-formylphenyl)-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | O=Cc1ccc(NC(=O)C2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C17H15NO3/c19-11-12-5-7-13(8-6-12)18-17(20)15-9-10-21-16-4-2-1-3-14(15)16/h1-8,11,15H,9-10H2,(H,18,20) |
| InChIKey | AJDQYRJBJYRPRM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|