C19H16N2O2S — CID 124527741
(4S)-N-(4-phenyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 124527741) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is (4S)-N-(4-phenyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | (4S)-N-(4-phenyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 124527741 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (4S)-N-(4-phenyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | O=C(Nc1scnc1-c1ccccc1)[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C19H16N2O2S/c22-18(15-10-11-23-16-9-5-4-8-14(15)16)21-19-17(20-12-24-19)13-6-2-1-3-7-13/h1-9,12,15H,10-11H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | PWLDENQRPZDQOP-HNNXBMFYSA-N |
| XLogP | 4.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |