C14H13ClN2O2S — CID 63708496
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 63708496) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 63708496 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | O=C(Nc1nc(CCl)cs1)C1CCOc2ccccc21 |
| InChI | InChI=1S/C14H13ClN2O2S/c15-7-9-8-20-14(16-9)17-13(18)11-5-6-19-12-4-2-1-3-10(11)12/h1-4,8,11H,5-7H2,(H,16,17,18) |
| InChIKey | BXKNJNFXGACMOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|