C20H21NO4S — CID 119241213
3-[[3-(3,4-dihydro-2H-chromene-4-carbonylamino)phenyl]methylsulfanyl]propanoic acid (PubChem CID 119241213) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[[3-(3,4-dihydro-2H-chromene-4-carbonylamino)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-(3,4-dihydro-2H-chromene-4-carbonylamino)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119241213 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[[3-(3,4-dihydro-2H-chromene-4-carbonylamino)phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)C2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C20H21NO4S/c22-19(23)9-11-26-13-14-4-3-5-15(12-14)21-20(24)17-8-10-25-18-7-2-1-6-16(17)18/h1-7,12,17H,8-11,13H2,(H,21,24)(H,22,23) |
| InChIKey | LIOYWZXYZKRDDR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|