C17H23NO3S — CID 119240965
3-[[3-(cyclohexanecarbonylamino)phenyl]methylsulfanyl]propanoic acid (PubChem CID 119240965) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-[[3-(cyclohexanecarbonylamino)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-(cyclohexanecarbonylamino)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119240965 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-[[3-(cyclohexanecarbonylamino)phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H23NO3S/c19-16(20)9-10-22-12-13-5-4-8-15(11-13)18-17(21)14-6-2-1-3-7-14/h4-5,8,11,14H,1-3,6-7,9-10,12H2,(H,18,21)(H,19,20) |
| InChIKey | YNUGIAAHKIILLH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|