C20H28N2O4S — CID 119241051
3-[[3-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 119241051) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-[[3-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119241051 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[[3-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)CNC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C20H28N2O4S/c23-18(12-15-5-2-1-3-6-15)21-13-19(24)22-17-8-4-7-16(11-17)14-27-10-9-20(25)26/h4,7-8,11,15H,1-3,5-6,9-10,12-14H2,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | BHUMWHINMRDIBK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|