C20H19F2NO3S — CID 119241222
3-[[3-[[2-(2,4-difluorophenyl)cyclopropanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 119241222) has the molecular formula C20H19F2NO3S and a molecular weight of 391.44 g/mol. Its IUPAC name is 3-[[3-[[2-(2,4-difluorophenyl)cyclopropanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[2-(2,4-difluorophenyl)cyclopropanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119241222 |
| Molecular Formula | C20H19F2NO3S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-[[3-[[2-(2,4-difluorophenyl)cyclopropanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)C2CC2c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H19F2NO3S/c21-13-4-5-15(18(22)9-13)16-10-17(16)20(26)23-14-3-1-2-12(8-14)11-27-7-6-19(24)25/h1-5,8-9,16-17H,6-7,10-11H2,(H,23,26)(H,24,25) |
| InChIKey | LGCHMARZFGYMHX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|