C28H20F6N4O2 — CID 169227473
4-(3,4-difluoropyrrolidin-1-yl)-N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 169227473) has the molecular formula C28H20F6N4O2 and a molecular weight of 558.48 g/mol. Its IUPAC name is 4-(3,4-difluoropyrrolidin-1-yl)-N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | 4-(3,4-difluoropyrrolidin-1-yl)-N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 169227473 |
| Molecular Formula | C28H20F6N4O2 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 4-(3,4-difluoropyrrolidin-1-yl)-N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | O=C(NN1CCOc2ccccc21)c1cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc2c1N1CC(F)C(F)C1 |
| InChI | InChI=1S/C28H20F6N4O2/c29-14-9-16(25(34)19(31)10-14)24-18(30)6-5-15-26(24)35-11-17(27(15)37-12-20(32)21(33)13-37)28(39)36-38-7-8-40-23-4-2-1-3-22(23)38/h1-6,9-11,20-21H,7-8,12-13H2,(H,36,39) |
| InChIKey | PODNIQVGLMXBES-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|