C28H23F3N4O2 — CID 155355669
N-(2,3-dihydroindol-1-yl)-4-morpholin-4-yl-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 155355669) has the molecular formula C28H23F3N4O2 and a molecular weight of 504.51 g/mol. Its IUPAC name is N-(2,3-dihydroindol-1-yl)-4-morpholin-4-yl-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | N-(2,3-dihydroindol-1-yl)-4-morpholin-4-yl-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 155355669 |
| Molecular Formula | C28H23F3N4O2 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-(2,3-dihydroindol-1-yl)-4-morpholin-4-yl-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | O=C(NN1CCc2ccccc21)c1cnc2c(-c3cc(F)cc(F)c3F)cccc2c1N1CCOCC1 |
| InChI | InChI=1S/C28H23F3N4O2/c29-18-14-21(25(31)23(30)15-18)19-5-3-6-20-26(19)32-16-22(27(20)34-10-12-37-13-11-34)28(36)33-35-9-8-17-4-1-2-7-24(17)35/h1-7,14-16H,8-13H2,(H,33,36) |
| InChIKey | MNDLPFFGUKMWNJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|