C25H20F3N5O3 — CID 155355625
N-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-[methoxy(methyl)amino]-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide (PubChem CID 155355625) has the molecular formula C25H20F3N5O3 and a molecular weight of 495.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-[methoxy(methyl)amino]-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-[methoxy(methyl)amino]-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 155355625 |
| Molecular Formula | C25H20F3N5O3 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-[methoxy(methyl)amino]-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide |
| SMILES | CON(C)c1c(C(=O)NN2CCOc3ccccc32)cnc2c(-c3cc(F)cc(F)c3F)nccc12 |
| InChI | InChI=1S/C25H20F3N5O3/c1-32(35-2)24-15-7-8-29-23(16-11-14(26)12-18(27)21(16)28)22(15)30-13-17(24)25(34)31-33-9-10-36-20-6-4-3-5-19(20)33/h3-8,11-13H,9-10H2,1-2H3,(H,31,34) |
| InChIKey | IJIQLLQOIQUHHE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|