C28H29F3N4O3S — CID 142508673
3,4-dihydro-2H-chromene;4-(dimethylamino)-5-methoxy-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide;methanethiol (PubChem CID 142508673) has the molecular formula C28H29F3N4O3S and a molecular weight of 558.63 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;4-(dimethylamino)-5-methoxy-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide;methanethiol.
| Compound Name | 3,4-dihydro-2H-chromene;4-(dimethylamino)-5-methoxy-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide;methanethiol |
|---|---|
| PubChem CID | 142508673 |
| Molecular Formula | C28H29F3N4O3S |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 3,4-dihydro-2H-chromene;4-(dimethylamino)-5-methoxy-8-(2,3,5-trifluorophenyl)-1,7-naphthyridine-3-carboxamide;methanethiol |
| SMILES | COc1cnc(-c2cc(F)cc(F)c2F)c2ncc(C(N)=O)c(N(C)C)c12.CS.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C18H15F3N4O2.C9H10O.CH4S/c1-25(2)17-10(18(22)26)6-23-16-13(17)12(27-3)7-24-15(16)9-4-8(19)5-11(20)14(9)21;1-2-6-9-8(4-1)5-3-7-10-9;1-2/h4-7H,1-3H3,(H2,22,26);1-2,4,6H,3,5,7H2;2H,1H3 |
| InChIKey | MQNGEJVKUKLQLN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|