About 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate
7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate (PubChem CID 144987123) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate |
| PubChem CID | 144987123 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate |
| SMILES | CNc1cnccc1C(=O)OC.COc1ccccc1-c1ccc2c(c1)OCCC2 |
| InChI | InChI=1S/C16H16O2.C8H10N2O2/c1-17-15-7-3-2-6-14(15)13-9-8-12-5-4-10-18-16(12)11-13;1-9-7-5-10-4-3-6(7)8(11)12-2/h2-3,6-9,11H,4-5,10H2,1H3;3-5,9H,1-2H3 |
| InChIKey | JUNHVEXGPYCKIH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate?
The IUPAC name of 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate (CID 144987123) is 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate.
What is the SMILES notation for 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate?
The canonical SMILES for 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate is CNc1cnccc1C(=O)OC.COc1ccccc1-c1ccc2c(c1)OCCC2.
What is the InChIKey of 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate?
The InChIKey is JUNHVEXGPYCKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2.C8H10N2O2/c1-17-15-7-3-2-6-14(15)13-9-8-12-5-4-10-18-16(12)11-13;1-9-7-5-10-4-3-6(7)8(11)12-2/h2-3,6-9,11H,4-5,10H2,1H3;3-5,9H,1-2H3.
What are the key properties of 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate?
7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate has a molecular weight of 406.48 g/mol, XLogP of 4.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methoxyphenyl)-3,4-dihydro-2H-chromene;methyl 3-(methylamino)pyridine-4-carboxylate is sourced from PubChem (CID 144987123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).